C17H20ClNO2 — CID 10425220
N-[(2S)-1-chloro-3-methylbutan-2-yl]-7-methoxynaphthalene-1-carboxamide (PubChem CID 10425220) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is N-[(2S)-1-chloro-3-methylbutan-2-yl]-7-methoxynaphthalene-1-carboxamide.
| Compound Name | N-[(2S)-1-chloro-3-methylbutan-2-yl]-7-methoxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 10425220 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(2S)-1-chloro-3-methylbutan-2-yl]-7-methoxynaphthalene-1-carboxamide |
| SMILES | COc1ccc2cccc(C(=O)N[C@H](CCl)C(C)C)c2c1 |
| InChI | InChI=1S/C17H20ClNO2/c1-11(2)16(10-18)19-17(20)14-6-4-5-12-7-8-13(21-3)9-15(12)14/h4-9,11,16H,10H2,1-3H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | LIEDMQKZACMRFJ-MRXNPFEDSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|