About phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene
phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene (PubChem CID 10425266) has the molecular formula C17H18N6
and a molecular weight of 306.37 g/mol. Its IUPAC name is phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene.
Molecular Properties
| Compound Name | phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene |
| PubChem CID | 10425266 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene |
| SMILES | c1ccc(/N=N/N2C[C@@H]3C[C@H]2CN3/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N6/c1-3-7-14(8-4-1)18-20-22-12-17-11-16(22)13-23(17)21-19-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/b20-18+,21-19+/t16-,17-/m0/s1 |
| InChIKey | LKZCZXMUTDAQPG-ZQUSJICXSA-N |
| XLogP | 4.14 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene?
The IUPAC name of phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene (CID 10425266) is phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene.
What is the SMILES notation for phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene?
The canonical SMILES for phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene is c1ccc(/N=N/N2C[C@@H]3C[C@H]2CN3/N=N/c2ccccc2)cc1.
What is the InChIKey of phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene?
The InChIKey is LKZCZXMUTDAQPG-ZQUSJICXSA-N. The full InChI is InChI=1S/C17H18N6/c1-3-7-14(8-4-1)18-20-22-12-17-11-16(22)13-23(17)21-19-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/b20-18+,21-19+/t16-,17-/m0/s1.
What are the key properties of phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene?
phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene has a molecular weight of 306.37 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[(1S,4S)-5-phenyldiazenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]diazene is sourced from PubChem (CID 10425266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).