About 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one
3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 10425386) has the molecular formula C16H12N4OS
and a molecular weight of 308.37 g/mol. Its IUPAC name is 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one.
Molecular Properties
| Compound Name | 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one |
| PubChem CID | 10425386 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | O=C1Nc2ccccc2CN1c1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C16H12N4OS/c21-15-18-13-6-2-1-4-12(13)9-20(15)16-19-14(10-22-16)11-5-3-7-17-8-11/h1-8,10H,9H2,(H,18,21) |
| InChIKey | FINBCMQWNUIQOI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one?
The IUPAC name of 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one (CID 10425386) is 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one.
What is the SMILES notation for 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one?
The canonical SMILES for 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one is O=C1Nc2ccccc2CN1c1nc(-c2cccnc2)cs1.
What is the InChIKey of 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one?
The InChIKey is FINBCMQWNUIQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4OS/c21-15-18-13-6-2-1-4-12(13)9-20(15)16-19-14(10-22-16)11-5-3-7-17-8-11/h1-8,10H,9H2,(H,18,21).
What are the key properties of 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one?
3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one has a molecular weight of 308.37 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one is sourced from PubChem (CID 10425386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).