About 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane
5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane (PubChem CID 10425413) has the molecular formula C18H32O2Si
and a molecular weight of 308.54 g/mol. Its IUPAC name is 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane |
| PubChem CID | 10425413 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane |
| SMILES | C=CCCC1(CCCC#C[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C18H32O2Si/c1-7-8-12-18(19-14-15-20-18)13-10-9-11-16-21(5,6)17(2,3)4/h7H,1,8-10,12-15H2,2-6H3 |
| InChIKey | NUKHUTWOHREYBT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane?
The IUPAC name of 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane (CID 10425413) is 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane.
What is the SMILES notation for 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane?
The canonical SMILES for 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane is C=CCCC1(CCCC#C[Si](C)(C)C(C)(C)C)OCCO1.
What is the InChIKey of 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane?
The InChIKey is NUKHUTWOHREYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2Si/c1-7-8-12-18(19-14-15-20-18)13-10-9-11-16-21(5,6)17(2,3)4/h7H,1,8-10,12-15H2,2-6H3.
What are the key properties of 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane?
5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane has a molecular weight of 308.54 g/mol, XLogP of 4.92, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-but-3-enyl-1,3-dioxolan-2-yl)pent-1-ynyl-tert-butyl-dimethylsilane is sourced from PubChem (CID 10425413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).