About (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate
(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate (PubChem CID 10425624) has the molecular formula C17H12O6
and a molecular weight of 312.28 g/mol. Its IUPAC name is (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate |
| PubChem CID | 10425624 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate |
| SMILES | CC(=O)OCc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C17H12O6/c1-8(18)23-7-9-5-11-15(13(20)6-9)17(22)14-10(16(11)21)3-2-4-12(14)19/h2-6,19-20H,7H2,1H3 |
| InChIKey | FUECAILUKAJTBR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate?
The IUPAC name of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate (CID 10425624) is (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate.
What is the SMILES notation for (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate?
The canonical SMILES for (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate is CC(=O)OCc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate?
The InChIKey is FUECAILUKAJTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O6/c1-8(18)23-7-9-5-11-15(13(20)6-9)17(22)14-10(16(11)21)3-2-4-12(14)19/h2-6,19-20H,7H2,1H3.
What are the key properties of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate?
(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate has a molecular weight of 312.28 g/mol, XLogP of 1.94, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl acetate is sourced from PubChem (CID 10425624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).