About 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid
2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid (PubChem CID 10425715) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid |
| PubChem CID | 10425715 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)OC(c2ccccc2)C1(O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO5/c19-14(20)11-18-16(21)23-15(12-7-3-1-4-8-12)17(18,22)13-9-5-2-6-10-13/h1-10,15,22H,11H2,(H,19,20) |
| InChIKey | RSUYUEBKQUBONB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid (CID 10425715) is 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid is O=C(O)CN1C(=O)OC(c2ccccc2)C1(O)c1ccccc1.
What is the InChIKey of 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid?
The InChIKey is RSUYUEBKQUBONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO5/c19-14(20)11-18-16(21)23-15(12-7-3-1-4-8-12)17(18,22)13-9-5-2-6-10-13/h1-10,15,22H,11H2,(H,19,20).
What are the key properties of 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid?
2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid has a molecular weight of 313.31 g/mol, XLogP of 2.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)acetic acid is sourced from PubChem (CID 10425715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).