About [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate
[(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 10425811) has the molecular formula C17H34O3Si
and a molecular weight of 314.54 g/mol. Its IUPAC name is [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate |
| PubChem CID | 10425811 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](/C=C/[C@@H](O)CCCOC(=O)C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C17H34O3Si/c1-7-21(8-2,9-3)14-12-15(18)11-10-13-20-16(19)17(4,5)6/h12,14-15,18H,7-11,13H2,1-6H3/b14-12+/t15-/m0/s1 |
| InChIKey | WQPOXWOHLKZYIH-ZQHYZAEZSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate?
The IUPAC name of [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate (CID 10425811) is [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate is CC[Si](/C=C/[C@@H](O)CCCOC(=O)C(C)(C)C)(CC)CC.
What is the InChIKey of [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate?
The InChIKey is WQPOXWOHLKZYIH-ZQHYZAEZSA-N. The full InChI is InChI=1S/C17H34O3Si/c1-7-21(8-2,9-3)14-12-15(18)11-10-13-20-16(19)17(4,5)6/h12,14-15,18H,7-11,13H2,1-6H3/b14-12+/t15-/m0/s1.
What are the key properties of [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate?
[(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate has a molecular weight of 314.54 g/mol, XLogP of 4.32, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4S)-4-hydroxy-6-triethylsilylhex-5-enyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 10425811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).