C15H28O5Si — CID 10425922
6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 10425922) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is 6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10425922 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(C[C@H](O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H28O5Si/c1-14(2,3)21(6,7)18-10-11(16)8-12-9-13(17)20-15(4,5)19-12/h9,11,16H,8,10H2,1-7H3/t11-/m0/s1 |
| InChIKey | ZJBDOBJGAAXOFY-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|