About (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one
(3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one (PubChem CID 10426229) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one |
| PubChem CID | 10426229 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one |
| SMILES | CC(C)c1cc(/C=C2\C(=O)Nc3ccccc32)cc(C(C)C)c1O |
| InChI | InChI=1S/C21H23NO2/c1-12(2)16-9-14(10-17(13(3)4)20(16)23)11-18-15-7-5-6-8-19(15)22-21(18)24/h5-13,23H,1-4H3,(H,22,24)/b18-11- |
| InChIKey | UGWOQEABVJFWIV-WQRHYEAKSA-N |
| XLogP | 5.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one?
The IUPAC name of (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one (CID 10426229) is (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one.
What is the SMILES notation for (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one?
The canonical SMILES for (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one is CC(C)c1cc(/C=C2\C(=O)Nc3ccccc32)cc(C(C)C)c1O.
What is the InChIKey of (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one?
The InChIKey is UGWOQEABVJFWIV-WQRHYEAKSA-N. The full InChI is InChI=1S/C21H23NO2/c1-12(2)16-9-14(10-17(13(3)4)20(16)23)11-18-15-7-5-6-8-19(15)22-21(18)24/h5-13,23H,1-4H3,(H,22,24)/b18-11-.
What are the key properties of (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one?
(3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one has a molecular weight of 321.42 g/mol, XLogP of 5.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one is sourced from PubChem (CID 10426229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).