C18H30O3Si — CID 10426305
(4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalene-1,7-dione (PubChem CID 10426305) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalene-1,7-dione.
| Compound Name | (4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalene-1,7-dione |
|---|---|
| PubChem CID | 10426305 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalene-1,7-dione |
| SMILES | CC1=C2C(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C18H30O3Si/c1-12-13(19)10-11-18(5)15(9-8-14(20)16(12)18)21-22(6,7)17(2,3)4/h15H,8-11H2,1-7H3/t15-,18+/m0/s1 |
| InChIKey | JIEPRXOZKRIEQC-MAUKXSAKSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|