About (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine
(Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine (PubChem CID 10426388) has the molecular formula C12H30ClNOSi3
and a molecular weight of 324.09 g/mol. Its IUPAC name is (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine |
| PubChem CID | 10426388 |
| Molecular Formula | C12H30ClNOSi3 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine |
| SMILES | C[Si](C)(C)O/C(=C\Cl)CN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H30ClNOSi3/c1-16(2,3)14(17(4,5)6)11-12(10-13)15-18(7,8)9/h10H,11H2,1-9H3/b12-10- |
| InChIKey | GKLHASZVKKFBSP-BENRWUELSA-N |
| XLogP | 4.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine?
The IUPAC name of (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine (CID 10426388) is (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine.
What is the SMILES notation for (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine?
The canonical SMILES for (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine is C[Si](C)(C)O/C(=C\Cl)CN([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine?
The InChIKey is GKLHASZVKKFBSP-BENRWUELSA-N. The full InChI is InChI=1S/C12H30ClNOSi3/c1-16(2,3)14(17(4,5)6)11-12(10-13)15-18(7,8)9/h10H,11H2,1-9H3/b12-10-.
What are the key properties of (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine?
(Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine has a molecular weight of 324.09 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-chloro-N,N-bis(trimethylsilyl)-2-trimethylsilyloxyprop-2-en-1-amine is sourced from PubChem (CID 10426388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).