C19H24N4O — CID 10426426
N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1-prop-2-enylpyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 10426426) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1-prop-2-enylpyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1-prop-2-enylpyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10426426 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1-prop-2-enylpyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)NC2C[C@H]3CC[C@@H](C2)N3C)c2cccnc21 |
| InChI | InChI=1S/C19H24N4O/c1-3-9-23-12-17(16-5-4-8-20-18(16)23)19(24)21-13-10-14-6-7-15(11-13)22(14)2/h3-5,8,12-15H,1,6-7,9-11H2,2H3,(H,21,24)/t13?,14-,15+ |
| InChIKey | MWRKIMHOQJQONW-GOOCMWNKSA-N |
| XLogP | 2.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|