C17H15N3O4 — CID 10426454
ethyl 2-(3-hydroxy-5-oxo-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-4-yl)acetate (PubChem CID 10426454) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is ethyl 2-(3-hydroxy-5-oxo-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-4-yl)acetate.
| Compound Name | ethyl 2-(3-hydroxy-5-oxo-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-4-yl)acetate |
|---|---|
| PubChem CID | 10426454 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | ethyl 2-(3-hydroxy-5-oxo-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-4-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2ncc3[nH]c4ccccc4c3c2C1O |
| InChI | InChI=1S/C17H15N3O4/c1-2-24-12(21)8-20-16(22)14-13-9-5-3-4-6-10(9)19-11(13)7-18-15(14)17(20)23/h3-7,16,19,22H,2,8H2,1H3 |
| InChIKey | CTBRFXKQMQIGON-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |