About 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one
1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one (PubChem CID 10426517) has the molecular formula C19H16F2N2O
and a molecular weight of 326.35 g/mol. Its IUPAC name is 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one |
| PubChem CID | 10426517 |
| Molecular Formula | C19H16F2N2O |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one |
| SMILES | Cc1cc(-c2c(F)cc3c(=O)ccn(C4CC4)c3c2F)cc(C)n1 |
| InChI | InChI=1S/C19H16F2N2O/c1-10-7-12(8-11(2)22-10)17-15(20)9-14-16(24)5-6-23(13-3-4-13)19(14)18(17)21/h5-9,13H,3-4H2,1-2H3 |
| InChIKey | AMOGCMAVQDCNND-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one?
The IUPAC name of 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one (CID 10426517) is 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one.
What is the SMILES notation for 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one?
The canonical SMILES for 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one is Cc1cc(-c2c(F)cc3c(=O)ccn(C4CC4)c3c2F)cc(C)n1.
What is the InChIKey of 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one?
The InChIKey is AMOGCMAVQDCNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2O/c1-10-7-12(8-11(2)22-10)17-15(20)9-14-16(24)5-6-23(13-3-4-13)19(14)18(17)21/h5-9,13H,3-4H2,1-2H3.
What are the key properties of 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one?
1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one has a molecular weight of 326.35 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-7-(2,6-dimethyl-4-pyridinyl)-6,8-difluoroquinolin-4-one is sourced from PubChem (CID 10426517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).