About dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride
dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride (PubChem CID 10426734) has the molecular formula C14H14Cl2Mg2N2
and a molecular weight of 329.80 g/mol. Its IUPAC name is dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride.
Molecular Properties
| Compound Name | dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride |
| PubChem CID | 10426734 |
| Molecular Formula | C14H14Cl2Mg2N2 |
| Molecular Weight | 329.80 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride |
| SMILES | C=CCC(=[N-])c1ccc(C(=[N-])CC=C)cc1.[Cl-].[Cl-].[Mg+2].[Mg+2] |
| InChI | InChI=1S/C14H14N2.2ClH.2Mg/c1-3-5-13(15)11-7-9-12(10-8-11)14(16)6-4-2;;;;/h3-4,7-10H,1-2,5-6H2;2*1H;;/q-2;;;2*+2/p-2 |
| InChIKey | QEYXYULPSZADRX-UHFFFAOYSA-L |
| XLogP | -3.20 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.80 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride?
The IUPAC name of dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride (CID 10426734) is dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride.
What is the SMILES notation for dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride?
The canonical SMILES for dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride is C=CCC(=[N-])c1ccc(C(=[N-])CC=C)cc1.[Cl-].[Cl-].[Mg+2].[Mg+2].
What is the InChIKey of dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride?
The InChIKey is QEYXYULPSZADRX-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H14N2.2ClH.2Mg/c1-3-5-13(15)11-7-9-12(10-8-11)14(16)6-4-2;;;;/h3-4,7-10H,1-2,5-6H2;2*1H;;/q-2;;;2*+2/p-2.
What are the key properties of dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride?
dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride has a molecular weight of 329.80 g/mol, XLogP of -3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimagnesium;1-[4-(1-azanidylidenebut-3-enyl)phenyl]but-3-enylideneazanide;dichloride is sourced from PubChem (CID 10426734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).