C20H29NO3 — CID 10426842
benzyl (2R,5R)-2-butyl-5-(4-oxobutyl)pyrrolidine-1-carboxylate (PubChem CID 10426842) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is benzyl (2R,5R)-2-butyl-5-(4-oxobutyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,5R)-2-butyl-5-(4-oxobutyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10426842 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | benzyl (2R,5R)-2-butyl-5-(4-oxobutyl)pyrrolidine-1-carboxylate |
| SMILES | CCCC[C@@H]1CC[C@@H](CCCC=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29NO3/c1-2-3-11-18-13-14-19(12-7-8-15-22)21(18)20(23)24-16-17-9-5-4-6-10-17/h4-6,9-10,15,18-19H,2-3,7-8,11-14,16H2,1H3/t18-,19-/m1/s1 |
| InChIKey | IWOAXVDOUSEMGH-RTBURBONSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|