C14H17F2NO6 — CID 10426919
(2S,3R,4S,5S,6R)-N-[(2,4-difluorophenyl)methyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide (PubChem CID 10426919) has the molecular formula C14H17F2NO6 and a molecular weight of 333.29 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-N-[(2,4-difluorophenyl)methyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide.
| Compound Name | (2S,3R,4S,5S,6R)-N-[(2,4-difluorophenyl)methyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 10426919 |
| Molecular Formula | C14H17F2NO6 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2S,3R,4S,5S,6R)-N-[(2,4-difluorophenyl)methyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17F2NO6/c15-7-2-1-6(8(16)3-7)4-17-14(22)13-12(21)11(20)10(19)9(5-18)23-13/h1-3,9-13,18-21H,4-5H2,(H,17,22)/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | RVZWFWHKCPOHST-LBELIVKGSA-N |
| XLogP | -1.58 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |