C20H30O4 — CID 10427018
14-hydroxy-6,6,9,13,15,16-hexamethyl-2,8-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-7-one (PubChem CID 10427018) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 14-hydroxy-6,6,9,13,15,16-hexamethyl-2,8-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-7-one.
| Compound Name | 14-hydroxy-6,6,9,13,15,16-hexamethyl-2,8-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-7-one |
|---|---|
| PubChem CID | 10427018 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 14-hydroxy-6,6,9,13,15,16-hexamethyl-2,8-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-7-one |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)OC(=O)C(C)(C)CCCO2 |
| InChI | InChI=1S/C20H30O4/c1-12-8-9-16-15(4)17(21)13(2)14(3)18(16)23-11-7-10-20(5,6)19(22)24-12/h12,21H,7-11H2,1-6H3 |
| InChIKey | QIEPHSMXXBTCDW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |