C22H26N2O — CID 10427024
(1Z,4Z)-1-amino-1,7-diphenyl-5-(propan-2-ylamino)hepta-1,4-dien-3-one (PubChem CID 10427024) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (1Z,4Z)-1-amino-1,7-diphenyl-5-(propan-2-ylamino)hepta-1,4-dien-3-one.
| Compound Name | (1Z,4Z)-1-amino-1,7-diphenyl-5-(propan-2-ylamino)hepta-1,4-dien-3-one |
|---|---|
| PubChem CID | 10427024 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1Z,4Z)-1-amino-1,7-diphenyl-5-(propan-2-ylamino)hepta-1,4-dien-3-one |
| SMILES | CC(C)N/C(=C\C(=O)/C=C(\N)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O/c1-17(2)24-20(14-13-18-9-5-3-6-10-18)15-21(25)16-22(23)19-11-7-4-8-12-19/h3-12,15-17,24H,13-14,23H2,1-2H3/b20-15-,22-16- |
| InChIKey | OBIHVZYTNWUSQO-MLCVWVIHSA-N |
| XLogP | 4.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|