About 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole
3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole (PubChem CID 10427137) has the molecular formula C22H25FN2
and a molecular weight of 336.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole |
| PubChem CID | 10427137 |
| Molecular Formula | C22H25FN2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole |
| SMILES | Cc1ccc2c(c1)c(-c1ccc(F)cc1)c(C)n2C1CCN(C)CC1 |
| InChI | InChI=1S/C22H25FN2/c1-15-4-9-21-20(14-15)22(17-5-7-18(23)8-6-17)16(2)25(21)19-10-12-24(3)13-11-19/h4-9,14,19H,10-13H2,1-3H3 |
| InChIKey | JHXVZNYMJMMPEI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole?
The IUPAC name of 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole (CID 10427137) is 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole.
What is the SMILES notation for 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole?
The canonical SMILES for 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole is Cc1ccc2c(c1)c(-c1ccc(F)cc1)c(C)n2C1CCN(C)CC1.
What is the InChIKey of 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole?
The InChIKey is JHXVZNYMJMMPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN2/c1-15-4-9-21-20(14-15)22(17-5-7-18(23)8-6-17)16(2)25(21)19-10-12-24(3)13-11-19/h4-9,14,19H,10-13H2,1-3H3.
What are the key properties of 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole?
3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole has a molecular weight of 336.45 g/mol, XLogP of 5.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-2,5-dimethyl-1-(1-methylpiperidin-4-yl)indole is sourced from PubChem (CID 10427137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).