C21H27N3O — CID 10427207
(6aR,9R)-7-methyl-N-[(2R)-pentan-2-yl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 10427207) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (6aR,9R)-7-methyl-N-[(2R)-pentan-2-yl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-7-methyl-N-[(2R)-pentan-2-yl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 10427207 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (6aR,9R)-7-methyl-N-[(2R)-pentan-2-yl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCC[C@@H](C)NC(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H27N3O/c1-4-6-13(2)23-21(25)15-9-17-16-7-5-8-18-20(16)14(11-22-18)10-19(17)24(3)12-15/h5,7-9,11,13,15,19,22H,4,6,10,12H2,1-3H3,(H,23,25)/t13-,15-,19-/m1/s1 |
| InChIKey | JGLCNUHMSLNTLJ-ZXYWRSMDSA-N |
| XLogP | 3.34 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |