About [1]benzofuro[2,3-b]pyridin-4-ylmethanol
[1]benzofuro[2,3-b]pyridin-4-ylmethanol (PubChem CID 1042736) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is [1]benzofuro[2,3-b]pyridin-4-ylmethanol.
Molecular Properties
| Compound Name | [1]benzofuro[2,3-b]pyridin-4-ylmethanol |
| PubChem CID | 1042736 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | [1]benzofuro[2,3-b]pyridin-4-ylmethanol |
| SMILES | OCc1ccnc2oc3ccccc3c12 |
| InChI | InChI=1S/C12H9NO2/c14-7-8-5-6-13-12-11(8)9-3-1-2-4-10(9)15-12/h1-6,14H,7H2 |
| InChIKey | XAVXKFRTMGXOJA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1]benzofuro[2,3-b]pyridin-4-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[2,3-b]pyridin-4-ylmethanol?
The IUPAC name of [1]benzofuro[2,3-b]pyridin-4-ylmethanol (CID 1042736) is [1]benzofuro[2,3-b]pyridin-4-ylmethanol.
What is the SMILES notation for [1]benzofuro[2,3-b]pyridin-4-ylmethanol?
The canonical SMILES for [1]benzofuro[2,3-b]pyridin-4-ylmethanol is OCc1ccnc2oc3ccccc3c12.
What is the InChIKey of [1]benzofuro[2,3-b]pyridin-4-ylmethanol?
The InChIKey is XAVXKFRTMGXOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-7-8-5-6-13-12-11(8)9-3-1-2-4-10(9)15-12/h1-6,14H,7H2.
What are the key properties of [1]benzofuro[2,3-b]pyridin-4-ylmethanol?
[1]benzofuro[2,3-b]pyridin-4-ylmethanol has a molecular weight of 199.21 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[2,3-b]pyridin-4-ylmethanol is sourced from PubChem (CID 1042736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).