C22H30O3 — CID 10427507
(2E,4E,6E,8E)-9-(4-ethyl-2,6,6-trimethyl-3-oxocyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 10427507) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(4-ethyl-2,6,6-trimethyl-3-oxocyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-9-(4-ethyl-2,6,6-trimethyl-3-oxocyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 10427507 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2E,4E,6E,8E)-9-(4-ethyl-2,6,6-trimethyl-3-oxocyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CCC1CC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C22H30O3/c1-7-18-14-22(5,6)19(17(4)21(18)25)12-11-15(2)9-8-10-16(3)13-20(23)24/h8-13,18H,7,14H2,1-6H3,(H,23,24)/b10-8+,12-11+,15-9+,16-13+ |
| InChIKey | JURNOODNKUMAQG-PAAZSCCJSA-N |
| XLogP | 5.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|