About 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline
3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline (PubChem CID 10427590) has the molecular formula C20H13FN4O
and a molecular weight of 344.35 g/mol. Its IUPAC name is 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline.
Molecular Properties
| Compound Name | 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline |
| PubChem CID | 10427590 |
| Molecular Formula | C20H13FN4O |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline |
| SMILES | Cc1ccc(-c2nc3ccccc3c(-n3cnc4cnccc43)c2F)o1 |
| InChI | InChI=1S/C20H13FN4O/c1-12-6-7-17(26-12)19-18(21)20(13-4-2-3-5-14(13)24-19)25-11-23-15-10-22-9-8-16(15)25/h2-11H,1H3 |
| InChIKey | KVYJOISBBHOSBH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline?
The IUPAC name of 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline (CID 10427590) is 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline.
What is the SMILES notation for 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline?
The canonical SMILES for 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline is Cc1ccc(-c2nc3ccccc3c(-n3cnc4cnccc43)c2F)o1.
What is the InChIKey of 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline?
The InChIKey is KVYJOISBBHOSBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13FN4O/c1-12-6-7-17(26-12)19-18(21)20(13-4-2-3-5-14(13)24-19)25-11-23-15-10-22-9-8-16(15)25/h2-11H,1H3.
What are the key properties of 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline?
3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline has a molecular weight of 344.35 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-imidazo[4,5-c]pyridin-1-yl-2-(5-methylfuran-2-yl)quinoline is sourced from PubChem (CID 10427590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).