About 3-methoxy-11H-chromeno[4,3-b]indol-6-one
3-methoxy-11H-chromeno[4,3-b]indol-6-one (PubChem CID 1042773) has the molecular formula C16H11NO3
and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-methoxy-11H-chromeno[4,3-b]indol-6-one.
Molecular Properties
| Compound Name | 3-methoxy-11H-chromeno[4,3-b]indol-6-one |
| PubChem CID | 1042773 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-methoxy-11H-chromeno[4,3-b]indol-6-one |
| SMILES | COc1ccc2c(c1)oc(=O)c1c3ccccc3[nH]c21 |
| InChI | InChI=1S/C16H11NO3/c1-19-9-6-7-11-13(8-9)20-16(18)14-10-4-2-3-5-12(10)17-15(11)14/h2-8,17H,1H3 |
| InChIKey | SSHNCYWELHWXQN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-11H-chromeno[4,3-b]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-11H-chromeno[4,3-b]indol-6-one?
The IUPAC name of 3-methoxy-11H-chromeno[4,3-b]indol-6-one (CID 1042773) is 3-methoxy-11H-chromeno[4,3-b]indol-6-one.
What is the SMILES notation for 3-methoxy-11H-chromeno[4,3-b]indol-6-one?
The canonical SMILES for 3-methoxy-11H-chromeno[4,3-b]indol-6-one is COc1ccc2c(c1)oc(=O)c1c3ccccc3[nH]c21.
What is the InChIKey of 3-methoxy-11H-chromeno[4,3-b]indol-6-one?
The InChIKey is SSHNCYWELHWXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO3/c1-19-9-6-7-11-13(8-9)20-16(18)14-10-4-2-3-5-12(10)17-15(11)14/h2-8,17H,1H3.
What are the key properties of 3-methoxy-11H-chromeno[4,3-b]indol-6-one?
3-methoxy-11H-chromeno[4,3-b]indol-6-one has a molecular weight of 265.27 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-11H-chromeno[4,3-b]indol-6-one is sourced from PubChem (CID 1042773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).