About 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid
5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid (PubChem CID 10427789) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid.
Molecular Properties
| Compound Name | 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid |
| PubChem CID | 10427789 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H21NO3/c24-22(25)13-7-8-14-26-21-16-19(17-9-3-1-4-10-17)15-20(23-21)18-11-5-2-6-12-18/h1-6,9-12,15-16H,7-8,13-14H2,(H,24,25) |
| InChIKey | WRMBYEARGLMSPC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid?
The IUPAC name of 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid (CID 10427789) is 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid.
What is the SMILES notation for 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid?
The canonical SMILES for 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid is O=C(O)CCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1.
What is the InChIKey of 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid?
The InChIKey is WRMBYEARGLMSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c24-22(25)13-7-8-14-26-21-16-19(17-9-3-1-4-10-17)15-20(23-21)18-11-5-2-6-12-18/h1-6,9-12,15-16H,7-8,13-14H2,(H,24,25).
What are the key properties of 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid?
5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid has a molecular weight of 347.41 g/mol, XLogP of 5.05, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,6-diphenyl-2-pyridinyl)oxy]pentanoic acid is sourced from PubChem (CID 10427789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).