C15H32N4O5 — CID 10427849
(1S,2S,3R,4R,5S,6R)-2-amino-3-[(2S,3S,6R)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol (PubChem CID 10427849) has the molecular formula C15H32N4O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,2S,3R,4R,5S,6R)-2-amino-3-[(2S,3S,6R)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol.
| Compound Name | (1S,2S,3R,4R,5S,6R)-2-amino-3-[(2S,3S,6R)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10427849 |
| Molecular Formula | C15H32N4O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (1S,2S,3R,4R,5S,6R)-2-amino-3-[(2S,3S,6R)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol |
| SMILES | CN[C@H]1[C@@H](O)[C@H](O[C@@H]2O[C@@H]([C@H](C)N)CC[C@@H]2N)[C@@H](N)[C@H](O)[C@@H]1OC |
| InChI | InChI=1S/C15H32N4O5/c1-6(16)8-5-4-7(17)15(23-8)24-13-9(18)11(20)14(22-3)10(19-2)12(13)21/h6-15,19-21H,4-5,16-18H2,1-3H3/t6-,7-,8+,9-,10-,11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | WFMQYKIRAVMXSU-FVLIGJTQSA-N |
| XLogP | -2.78 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |