C11H14Cl2N3O4P — CID 10428186
N,N-bis(2-chloroethyl)-7-nitro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine (PubChem CID 10428186) has the molecular formula C11H14Cl2N3O4P and a molecular weight of 354.13 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-7-nitro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine.
| Compound Name | N,N-bis(2-chloroethyl)-7-nitro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine |
|---|---|
| PubChem CID | 10428186 |
| Molecular Formula | C11H14Cl2N3O4P |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N,N-bis(2-chloroethyl)-7-nitro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)NP(=O)(N(CCCl)CCCl)OC2 |
| InChI | InChI=1S/C11H14Cl2N3O4P/c12-3-5-15(6-4-13)21(19)14-11-7-10(16(17)18)2-1-9(11)8-20-21/h1-2,7H,3-6,8H2,(H,14,19) |
| InChIKey | VSIHRFPBBCZTCY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|