C20H38O3Si — CID 10428250
butan-2-yl (2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate (PubChem CID 10428250) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is butan-2-yl (2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate.
| Compound Name | butan-2-yl (2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 10428250 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | butan-2-yl (2R,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
| SMILES | CCC(C)OC(=O)[C@@H]1C[C@@H]2CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C20H38O3Si/c1-8-14(2)22-19(21)16-12-15-10-9-11-18(17(15)13-16)23-24(6,7)20(3,4)5/h14-18H,8-13H2,1-7H3/t14?,15-,16+,17+,18-/m0/s1 |
| InChIKey | YUJSYAYBWUFPJW-WBUQSJCKSA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|