C20H34BNO2S — CID 10428782
(1S,5R,7R)-2-(1-dibutylboranyloxyethenyl)-10,10-dimethyl-4-oxa-2-azatricyclo[5.2.1.01,5]decane-3-thione (PubChem CID 10428782) has the molecular formula C20H34BNO2S and a molecular weight of 363.38 g/mol. Its IUPAC name is (1S,5R,7R)-2-(1-dibutylboranyloxyethenyl)-10,10-dimethyl-4-oxa-2-azatricyclo[5.2.1.01,5]decane-3-thione.
| Compound Name | (1S,5R,7R)-2-(1-dibutylboranyloxyethenyl)-10,10-dimethyl-4-oxa-2-azatricyclo[5.2.1.01,5]decane-3-thione |
|---|---|
| PubChem CID | 10428782 |
| Molecular Formula | C20H34BNO2S |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (1S,5R,7R)-2-(1-dibutylboranyloxyethenyl)-10,10-dimethyl-4-oxa-2-azatricyclo[5.2.1.01,5]decane-3-thione |
| SMILES | C=C(OB(CCCC)CCCC)N1C(=S)O[C@@H]2C[C@H]3CC[C@]21C3(C)C |
| InChI | InChI=1S/C20H34BNO2S/c1-6-8-12-21(13-9-7-2)24-15(3)22-18(25)23-17-14-16-10-11-20(17,22)19(16,4)5/h16-17H,3,6-14H2,1-2,4-5H3/t16-,17-,20-/m1/s1 |
| InChIKey | ITFOCHINGAZPOP-MBOZVWFJSA-N |
| XLogP | 5.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|