C23H28N2O2 — CID 10428881
N-[4-[[(1S,9S,13S)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]phenyl]acetamide (PubChem CID 10428881) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[4-[[(1S,9S,13S)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(1S,9S,13S)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10428881 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[4-[[(1S,9S,13S)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CC[C@]3(C)c4cc(O)ccc4C[C@H]2[C@H]3C)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-15-22-12-18-6-9-20(27)13-21(18)23(15,3)10-11-25(22)14-17-4-7-19(8-5-17)24-16(2)26/h4-9,13,15,22,27H,10-12,14H2,1-3H3,(H,24,26)/t15-,22+,23+/m1/s1 |
| InChIKey | JWXPPVJRCLFJOJ-QABPDZFRSA-N |
| XLogP | 4.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |