C24H30O3 — CID 10428990
methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-ynylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 10428990) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-ynylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-ynylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 10428990 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-ynylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | C#CCC1CC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC)=C(C)C1=O |
| InChI | InChI=1S/C24H30O3/c1-8-10-20-16-24(5,6)21(19(4)23(20)26)14-13-17(2)11-9-12-18(3)15-22(25)27-7/h1,9,11-15,20H,10,16H2,2-7H3/b12-9+,14-13+,17-11+,18-15+ |
| InChIKey | MEQFYCQFBYEFEX-YNTITBQSSA-N |
| XLogP | 5.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|