C9H18O3S6 — CID 10428999
1,2,6,7,11,12-hexathiacyclopentadecane-4,9,14-triol (PubChem CID 10428999) has the molecular formula C9H18O3S6 and a molecular weight of 366.64 g/mol. Its IUPAC name is 1,2,6,7,11,12-hexathiacyclopentadecane-4,9,14-triol.
| Compound Name | 1,2,6,7,11,12-hexathiacyclopentadecane-4,9,14-triol |
|---|---|
| PubChem CID | 10428999 |
| Molecular Formula | C9H18O3S6 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1,2,6,7,11,12-hexathiacyclopentadecane-4,9,14-triol |
| SMILES | OC1CSSCC(O)CSSCC(O)CSSC1 |
| InChI | InChI=1S/C9H18O3S6/c10-7-1-13-14-3-8(11)4-17-18-6-9(12)5-16-15-2-7/h7-12H,1-6H2 |
| InChIKey | NGUMVQCHIOFLOU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|