About bis(2-(azidomethyl)pyran-4-one);zinc
bis(2-(azidomethyl)pyran-4-one);zinc (PubChem CID 10429072) has the molecular formula C12H10N6O4Zn
and a molecular weight of 367.64 g/mol. Its IUPAC name is bis(2-(azidomethyl)pyran-4-one);zinc.
Molecular Properties
| Compound Name | bis(2-(azidomethyl)pyran-4-one);zinc |
| PubChem CID | 10429072 |
| Molecular Formula | C12H10N6O4Zn |
| Molecular Weight | 367.64 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | bis(2-(azidomethyl)pyran-4-one);zinc |
| SMILES | [N-]=[N+]=NCc1cc(=O)cco1.[N-]=[N+]=NCc1cc(=O)cco1.[Zn] |
| InChI | InChI=1S/2C6H5N3O2.Zn/c2*7-9-8-4-6-3-5(10)1-2-11-6;/h2*1-3H,4H2; |
| InChIKey | FEODUWWZMLSWDM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 157.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(azidomethyl)pyran-4-one);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(azidomethyl)pyran-4-one);zinc?
The IUPAC name of bis(2-(azidomethyl)pyran-4-one);zinc (CID 10429072) is bis(2-(azidomethyl)pyran-4-one);zinc.
What is the SMILES notation for bis(2-(azidomethyl)pyran-4-one);zinc?
The canonical SMILES for bis(2-(azidomethyl)pyran-4-one);zinc is [N-]=[N+]=NCc1cc(=O)cco1.[N-]=[N+]=NCc1cc(=O)cco1.[Zn].
What is the InChIKey of bis(2-(azidomethyl)pyran-4-one);zinc?
The InChIKey is FEODUWWZMLSWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5N3O2.Zn/c2*7-9-8-4-6-3-5(10)1-2-11-6;/h2*1-3H,4H2;.
What are the key properties of bis(2-(azidomethyl)pyran-4-one);zinc?
bis(2-(azidomethyl)pyran-4-one);zinc has a molecular weight of 367.64 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(azidomethyl)pyran-4-one);zinc is sourced from PubChem (CID 10429072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).