4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid

C20H19NO4S — CID 10429181

IUPAC4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid
SMILESCCOc1ccc(-c2nc(-c3ccc(C(=O)O)cc3)cs2)cc1OCC
InChIInChI=1S/C20H19NO4S/c1-3-24-17-10-9-15(11-18(17)25-4-2)19-21-16(12-26-19)13-5-7-14(8-6-13)20(22)23/h5-12H,3-4H2,1-2H3,(H,22,23)
InChIKeyGLWZNXDMMNXIOW-UHFFFAOYSA-N
MW369.44 g/mol
LogP4.97
Rot. Bonds7

About 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid

4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 10429181) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid.

Molecular Properties

Compound Name4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid
PubChem CID10429181
Molecular FormulaC20H19NO4S
Molecular Weight369.44 g/mol
Exact Mass369.10
IUPAC Name4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid
SMILESCCOc1ccc(-c2nc(-c3ccc(C(=O)O)cc3)cs2)cc1OCC
InChIInChI=1S/C20H19NO4S/c1-3-24-17-10-9-15(11-18(17)25-4-2)19-21-16(12-26-19)13-5-7-14(8-6-13)20(22)23/h5-12H,3-4H2,1-2H3,(H,22,23)
InChIKeyGLWZNXDMMNXIOW-UHFFFAOYSA-N
XLogP4.97
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500369.44
LogP ≤ 54.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid?
The IUPAC name of 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid (CID 10429181) is 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid.
What is the SMILES notation for 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid?
The canonical SMILES for 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid is CCOc1ccc(-c2nc(-c3ccc(C(=O)O)cc3)cs2)cc1OCC.
What is the InChIKey of 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid?
The InChIKey is GLWZNXDMMNXIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4S/c1-3-24-17-10-9-15(11-18(17)25-4-2)19-21-16(12-26-19)13-5-7-14(8-6-13)20(22)23/h5-12H,3-4H2,1-2H3,(H,22,23).
What are the key properties of 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid?
4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid has a molecular weight of 369.44 g/mol, XLogP of 4.97, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]benzoic acid is sourced from PubChem (CID 10429181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).