C18H10O9 — CID 10429214
[1,4]benzodioxino[2,3-a]oxanthrene-1,3,6,9,11-pentol (PubChem CID 10429214) has the molecular formula C18H10O9 and a molecular weight of 370.27 g/mol. Its IUPAC name is [1,4]benzodioxino[2,3-a]oxanthrene-1,3,6,9,11-pentol.
| Compound Name | [1,4]benzodioxino[2,3-a]oxanthrene-1,3,6,9,11-pentol |
|---|---|
| PubChem CID | 10429214 |
| Molecular Formula | C18H10O9 |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [1,4]benzodioxino[2,3-a]oxanthrene-1,3,6,9,11-pentol |
| SMILES | Oc1cc(O)c2oc3cc(O)c4oc5cc(O)cc(O)c5oc4c3oc2c1 |
| InChI | InChI=1S/C18H10O9/c19-6-1-8(21)14-11(3-6)26-17-13(24-14)5-10(23)16-18(17)27-15-9(22)2-7(20)4-12(15)25-16/h1-5,19-23H |
| InChIKey | LBHQACSAGWCMAB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|