C22H26ClNO2 — CID 10429331
4-[(4aS,5R,9bS)-2-ethyl-7-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-yl]benzoic acid;hydrochloride (PubChem CID 10429331) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 4-[(4aS,5R,9bS)-2-ethyl-7-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-yl]benzoic acid;hydrochloride.
| Compound Name | 4-[(4aS,5R,9bS)-2-ethyl-7-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 10429331 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-[(4aS,5R,9bS)-2-ethyl-7-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-yl]benzoic acid;hydrochloride |
| SMILES | CCN1CC[C@H]2[C@H](c3ccc(C(=O)O)cc3)c3cc(C)ccc3[C@H]2C1.Cl |
| InChI | InChI=1S/C22H25NO2.ClH/c1-3-23-11-10-18-20(13-23)17-9-4-14(2)12-19(17)21(18)15-5-7-16(8-6-15)22(24)25;/h4-9,12,18,20-21H,3,10-11,13H2,1-2H3,(H,24,25);1H/t18-,20-,21+;/m1./s1 |
| InChIKey | ZDWZNKMIYHQQKH-CAQXQSSJSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |