About 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide
8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide (PubChem CID 10429614) has the molecular formula C23H24N2O3
and a molecular weight of 376.46 g/mol. Its IUPAC name is 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide.
Molecular Properties
| Compound Name | 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide |
| PubChem CID | 10429614 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide |
| SMILES | O=C(CCCCCCC(=O)c1ncco1)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O3/c26-21(23-24-15-16-28-23)13-6-1-2-7-14-22(27)25-20-12-8-11-19(17-20)18-9-4-3-5-10-18/h3-5,8-12,15-17H,1-2,6-7,13-14H2,(H,25,27) |
| InChIKey | ICFCPTJGLMKNHK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide?
The IUPAC name of 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide (CID 10429614) is 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide.
What is the SMILES notation for 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide?
The canonical SMILES for 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide is O=C(CCCCCCC(=O)c1ncco1)Nc1cccc(-c2ccccc2)c1.
What is the InChIKey of 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide?
The InChIKey is ICFCPTJGLMKNHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O3/c26-21(23-24-15-16-28-23)13-6-1-2-7-14-22(27)25-20-12-8-11-19(17-20)18-9-4-3-5-10-18/h3-5,8-12,15-17H,1-2,6-7,13-14H2,(H,25,27).
What are the key properties of 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide?
8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide has a molecular weight of 376.46 g/mol, XLogP of 5.50, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,3-oxazol-2-yl)-8-oxo-N-(3-phenylphenyl)octanamide is sourced from PubChem (CID 10429614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).