C26H34O2 — CID 10429766
(2E,4E)-3-methyl-5-[(1R,5R)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1-bicyclo[3.1.0]hexanyl]penta-2,4-dienoic acid (PubChem CID 10429766) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-[(1R,5R)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1-bicyclo[3.1.0]hexanyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-methyl-5-[(1R,5R)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1-bicyclo[3.1.0]hexanyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10429766 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (2E,4E)-3-methyl-5-[(1R,5R)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1-bicyclo[3.1.0]hexanyl]penta-2,4-dienoic acid |
| SMILES | CC(/C=C/[C@]12CCC[C@@]1(c1ccc3c(c1)C(C)(C)CCC3(C)C)C2)=C\C(=O)O |
| InChI | InChI=1S/C26H34O2/c1-18(15-22(27)28)9-12-25-10-6-11-26(25,17-25)19-7-8-20-21(16-19)24(4,5)14-13-23(20,2)3/h7-9,12,15-16H,6,10-11,13-14,17H2,1-5H3,(H,27,28)/b12-9+,18-15+/t25-,26-/m0/s1 |
| InChIKey | WYLRCUSVWGFVQB-FCYKCFNLSA-N |
| XLogP | 6.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|