C21H32O6 — CID 10429874
(1R,2S,5E,10R,11S,12R,15S,20R)-15-hydroperoxy-2,6,10-trimethyl-13,18,21-trioxatetracyclo[10.6.2.12,11.015,20]henicos-5-en-14-one (PubChem CID 10429874) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (1R,2S,5E,10R,11S,12R,15S,20R)-15-hydroperoxy-2,6,10-trimethyl-13,18,21-trioxatetracyclo[10.6.2.12,11.015,20]henicos-5-en-14-one.
| Compound Name | (1R,2S,5E,10R,11S,12R,15S,20R)-15-hydroperoxy-2,6,10-trimethyl-13,18,21-trioxatetracyclo[10.6.2.12,11.015,20]henicos-5-en-14-one |
|---|---|
| PubChem CID | 10429874 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1R,2S,5E,10R,11S,12R,15S,20R)-15-hydroperoxy-2,6,10-trimethyl-13,18,21-trioxatetracyclo[10.6.2.12,11.015,20]henicos-5-en-14-one |
| SMILES | C/C1=C\CC[C@]2(C)O[C@H]([C@@H]3OC(=O)[C@]4(OO)CCO[C@@H]2C[C@H]34)[C@H](C)CCC1 |
| InChI | InChI=1S/C21H32O6/c1-13-6-4-8-14(2)17-18-15-12-16(20(3,26-17)9-5-7-13)24-11-10-21(15,27-23)19(22)25-18/h7,14-18,23H,4-6,8-12H2,1-3H3/b13-7+/t14-,15-,16-,17+,18-,20+,21+/m1/s1 |
| InChIKey | IIEYUXOIXOZQQX-CYBZCCGASA-N |
| XLogP | 3.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|