About (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone
(4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone (PubChem CID 1042999) has the molecular formula C21H16N2O3S
and a molecular weight of 376.44 g/mol. Its IUPAC name is (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone |
| PubChem CID | 1042999 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone |
| SMILES | O=C(C1=C(Nc2ccccc2)c2ccccc2S(=O)(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O3S/c24-21(15-9-3-1-4-10-15)20-19(22-16-11-5-2-6-12-16)17-13-7-8-14-18(17)27(25,26)23-20/h1-14,22-23H |
| InChIKey | SKIUFFVGBXNDNP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone?
The IUPAC name of (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone (CID 1042999) is (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone.
What is the SMILES notation for (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone?
The canonical SMILES for (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone is O=C(C1=C(Nc2ccccc2)c2ccccc2S(=O)(=O)N1)c1ccccc1.
What is the InChIKey of (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone?
The InChIKey is SKIUFFVGBXNDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3S/c24-21(15-9-3-1-4-10-15)20-19(22-16-11-5-2-6-12-16)17-13-7-8-14-18(17)27(25,26)23-20/h1-14,22-23H.
What are the key properties of (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone?
(4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone has a molecular weight of 376.44 g/mol, XLogP of 3.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-anilino-1,1-dioxo-2H-1lambda6,2-benzothiazin-3-yl)-phenylmethanone is sourced from PubChem (CID 1042999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).