About dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate
dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate (PubChem CID 10430041) has the molecular formula C22H25NO5
and a molecular weight of 383.44 g/mol. Its IUPAC name is dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate |
| PubChem CID | 10430041 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](C)ON(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO5/c1-16-14-22(20(24)26-2,21(25)27-3)19(18-12-8-5-9-13-18)23(28-16)15-17-10-6-4-7-11-17/h4-13,16,19H,14-15H2,1-3H3/t16-,19+/m0/s1 |
| InChIKey | RMRBDVNUKFUUHT-QFBILLFUSA-N |
| XLogP | 3.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate?
The IUPAC name of dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate (CID 10430041) is dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate.
What is the SMILES notation for dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate?
The canonical SMILES for dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate is COC(=O)C1(C(=O)OC)C[C@H](C)ON(Cc2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate?
The InChIKey is RMRBDVNUKFUUHT-QFBILLFUSA-N. The full InChI is InChI=1S/C22H25NO5/c1-16-14-22(20(24)26-2,21(25)27-3)19(18-12-8-5-9-13-18)23(28-16)15-17-10-6-4-7-11-17/h4-13,16,19H,14-15H2,1-3H3/t16-,19+/m0/s1.
What are the key properties of dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate?
dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate has a molecular weight of 383.44 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (3R,6S)-2-benzyl-6-methyl-3-phenyloxazinane-4,4-dicarboxylate is sourced from PubChem (CID 10430041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).