About 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone
1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone (PubChem CID 10430314) has the molecular formula C24H25N3O2
and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone.
Molecular Properties
| Compound Name | 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone |
| PubChem CID | 10430314 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CC[N+]([O-])(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C24H25N3O2/c28-24(23(21-9-3-1-4-10-21)22-11-5-2-6-12-22)26-14-16-27(29,17-15-26)19-20-8-7-13-25-18-20/h1-13,18,23H,14-17,19H2 |
| InChIKey | RTLDGXJSLFCQSJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone?
The IUPAC name of 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone (CID 10430314) is 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone.
What is the SMILES notation for 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone?
The canonical SMILES for 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone is O=C(C(c1ccccc1)c1ccccc1)N1CC[N+]([O-])(Cc2cccnc2)CC1.
What is the InChIKey of 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone?
The InChIKey is RTLDGXJSLFCQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O2/c28-24(23(21-9-3-1-4-10-21)22-11-5-2-6-12-22)26-14-16-27(29,17-15-26)19-20-8-7-13-25-18-20/h1-13,18,23H,14-17,19H2.
What are the key properties of 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone?
1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone has a molecular weight of 387.48 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-oxido-4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone is sourced from PubChem (CID 10430314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).