C8H4F4N4O4S3 — CID 10430595
5-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 10430595) has the molecular formula C8H4F4N4O4S3 and a molecular weight of 392.34 g/mol. Its IUPAC name is 5-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10430595 |
| Molecular Formula | C8H4F4N4O4S3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 5-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NS(=O)(=O)c2c(F)c(F)cc(F)c2F)s1 |
| InChI | InChI=1S/C8H4F4N4O4S3/c9-2-1-3(10)5(12)6(4(2)11)23(19,20)16-7-14-15-8(21-7)22(13,17)18/h1H,(H,14,16)(H2,13,17,18) |
| InChIKey | PKIBTPDYAFKEOS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|