C26H41N3 — CID 10430819
(3aS,6aR)-2-methyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine] (PubChem CID 10430819) has the molecular formula C26H41N3 and a molecular weight of 395.64 g/mol. Its IUPAC name is (3aS,6aR)-2-methyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine].
| Compound Name | (3aS,6aR)-2-methyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine] |
|---|---|
| PubChem CID | 10430819 |
| Molecular Formula | C26H41N3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | (3aS,6aR)-2-methyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine] |
| SMILES | CC(C)C1CCC(N2CCC3(CC2)[C@@H]2CN(C)C[C@@H]2CN3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H41N3/c1-20(2)21-9-11-23(12-10-21)28-15-13-26(14-16-28)25-19-27(3)17-22(25)18-29(26)24-7-5-4-6-8-24/h4-8,20-23,25H,9-19H2,1-3H3/t21?,22-,23?,25-/m1/s1 |
| InChIKey | TWXXTQVPYDAIBV-GRQIWCRBSA-N |
| XLogP | 4.73 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |