C21H15F3N4O — CID 10430847
5-methyl-N-quinolin-5-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 10430847) has the molecular formula C21H15F3N4O and a molecular weight of 396.37 g/mol. Its IUPAC name is 5-methyl-N-quinolin-5-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-quinolin-5-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 10430847 |
| Molecular Formula | C21H15F3N4O |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-methyl-N-quinolin-5-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc3ncccc23)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F3N4O/c1-13-11-19(27-28(13)15-6-2-5-14(12-15)21(22,23)24)20(29)26-18-9-3-8-17-16(18)7-4-10-25-17/h2-12H,1H3,(H,26,29) |
| InChIKey | QKBBWAFNMUOVAZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |