C23H44O3Si — CID 10430887
(E,2S,6R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,8-tetramethyl-10-methylidenedodec-4-enal (PubChem CID 10430887) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is (E,2S,6R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,8-tetramethyl-10-methylidenedodec-4-enal.
| Compound Name | (E,2S,6R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,8-tetramethyl-10-methylidenedodec-4-enal |
|---|---|
| PubChem CID | 10430887 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (E,2S,6R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,8-tetramethyl-10-methylidenedodec-4-enal |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(O)[C@H](C)/C=C(\C)CC(C)C=O |
| InChI | InChI=1S/C23H44O3Si/c1-12-18(4)22(26-27(10,11)23(7,8)9)20(6)21(25)19(5)14-16(2)13-17(3)15-24/h14-15,17,19-22,25H,4,12-13H2,1-3,5-11H3/b16-14+/t17?,19-,20-,21?,22-/m1/s1 |
| InChIKey | LEVKHZYAVHYRCK-OERFOWNLSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|