C20H38O4Si2 — CID 10431005
diethyl (2E,7E)-2,7-bis(trimethylsilylmethylidene)octanedioate (PubChem CID 10431005) has the molecular formula C20H38O4Si2 and a molecular weight of 398.69 g/mol. Its IUPAC name is diethyl (2E,7E)-2,7-bis(trimethylsilylmethylidene)octanedioate.
| Compound Name | diethyl (2E,7E)-2,7-bis(trimethylsilylmethylidene)octanedioate |
|---|---|
| PubChem CID | 10431005 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | diethyl (2E,7E)-2,7-bis(trimethylsilylmethylidene)octanedioate |
| SMILES | CCOC(=O)/C(=C/[Si](C)(C)C)CCCC/C(=C\[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H38O4Si2/c1-9-23-19(21)17(15-25(3,4)5)13-11-12-14-18(16-26(6,7)8)20(22)24-10-2/h15-16H,9-14H2,1-8H3/b17-15+,18-16+ |
| InChIKey | GMHNSAIKKUQDLM-YTEMWHBBSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|