C18H14BrN3O3 — CID 10431084
7-bromo-2,3-dioxo-N-phenyl-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-12-carboxamide (PubChem CID 10431084) has the molecular formula C18H14BrN3O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is 7-bromo-2,3-dioxo-N-phenyl-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-12-carboxamide.
| Compound Name | 7-bromo-2,3-dioxo-N-phenyl-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-12-carboxamide |
|---|---|
| PubChem CID | 10431084 |
| Molecular Formula | C18H14BrN3O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 7-bromo-2,3-dioxo-N-phenyl-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-12-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCc2cc(Br)cc3[nH]c(=O)c(=O)n1c23 |
| InChI | InChI=1S/C18H14BrN3O3/c19-11-8-10-6-7-14(16(23)20-12-4-2-1-3-5-12)22-15(10)13(9-11)21-17(24)18(22)25/h1-5,8-9,14H,6-7H2,(H,20,23)(H,21,24) |
| InChIKey | AEYYTIMUSGSMPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|