C20H25ClN6O — CID 10431144
[(2R)-1-[6-[(4-chlorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 10431144) has the molecular formula C20H25ClN6O and a molecular weight of 400.91 g/mol. Its IUPAC name is [(2R)-1-[6-[(4-chlorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[6-[(4-chlorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 10431144 |
| Molecular Formula | C20H25ClN6O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(2R)-1-[6-[(4-chlorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)n1cnc2c(NCc3ccc(Cl)cc3)nc(N3CCC[C@@H]3CO)nc21 |
| InChI | InChI=1S/C20H25ClN6O/c1-13(2)27-12-23-17-18(22-10-14-5-7-15(21)8-6-14)24-20(25-19(17)27)26-9-3-4-16(26)11-28/h5-8,12-13,16,28H,3-4,9-11H2,1-2H3,(H,22,24,25)/t16-/m1/s1 |
| InChIKey | KMXQXOQQGANJGB-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |